| Name |
Mesquitol-4beta-ol |
| Formula |
C15H14O7 |
| Mw |
306.0739528 |
| CAS RN |
38081-15-1 |
| C_ID |
C00009009
, 
|
| InChIKey |
JEUXGAUBSWADEA-XHEQNKOONA-N |
| InChICode |
InChI=1S/C15H14O7/c16-8-3-1-6(5-10(8)18)14-13(21)11(19)7-2-4-9(17)12(20)15(7)22-14/h1-5,11,13-14,16-21H/t11-,13-,14+/m0/s1 |
| SMILES |
Oc1ccc([C@H]2Oc3c(ccc(O)c3O)[C@H](O)[C@@H]2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia excelsa | Ref. |
| Plantae | Fabaceae | Acacia harpophylla | Ref. |
| Plantae | Fabaceae | Acacia nigrescens | Ref. |
| Plantae | Fabaceae | Prosopis glandulosa  | Ref. |
|
|
zoom in
| Organism | Acacia harpophylla | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Fourie,Phytochem.,11,(1972),1763 |
|---|
|