| Name |
ent-Epifisetinidol-4beta-ol |
| Formula |
C15H14O6 |
| Mw |
290.07903818 |
| CAS RN |
967-28-2 |
| C_ID |
C00008999
, 
|
| InChIKey |
OFZBQQUVMQGHDJ-JCUKGLBFNA-N |
| InChICode |
InChI=1S/C15H14O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,13-20H/t13-,14-,15-/m0/s1 |
| SMILES |
Oc1ccc2c(c1)O[C@@H](c1ccc(O)c(O)c1)[C@@H](O)[C@H]2O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Schinopsis lorentzii  | Ref. |
| Plantae | Fabaceae | Acacia mearnsii | Ref. |
| Plantae | Fabaceae | Colophospermum mopane | Ref. |
| Plantae | Fabaceae | Guibourtia coleosperma | Ref. |
|
|
zoom in
| Organism | Acacia mearnsii |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Drewes,Phytochem.,8,(1969),1039 |
|---|
|
