| Name |
Catechin 5-O-gallate |
| Formula |
C22H18O10 |
| Mw |
442.0899968 |
| CAS RN |
128232-62-2 |
| C_ID |
C00008871
, 
|
| InChIKey |
LVJJFMLUMNSUFN-AURADERDNA-N |
| InChICode |
InChI=1S/C22H18O10/c23-11-6-18-12(8-17(28)21(31-18)9-1-2-13(24)14(25)3-9)19(7-11)32-22(30)10-4-15(26)20(29)16(27)5-10/h1-7,17,21,23-29H,8H2/t17-,21+/m0/s1 |
| SMILES |
O=C(Oc1cc(O)cc2c1C[C@H](O)[C@@H](c1ccc(O)c(O)c1)O2)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia gerrardii  | Ref. |
| Plantae | Fabaceae | Acacia nilotica  | Ref. |
| Plantae | Myrtaceae | Plinia cauliflora | Ref. |
|
|
zoom in
| Organism | Acacia nilotica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Malan,Phytochem.,30,(1990),2737 |
|---|
|