| Name |
Epicatechin-5-O-beta-D-glucopyranoside (-)-Epicatechin-5-O-beta-D-glucopyranoside |
| Formula |
C21H24O11 |
| Mw |
452.13186161 |
| CAS RN |
131831-20-4 |
| C_ID |
C00008847
, 
|
| InChIKey |
ZESJTWVSXGZYTD-PDLHSIMXNA-N |
| InChICode |
InChI=1S/C21H24O11/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-5-9(23)4-14-10(15)6-13(26)20(30-14)8-1-2-11(24)12(25)3-8/h1-5,13,16-29H,6-7H2/t13-,16+,17-,18+,19+,20-,21-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc(O)cc3c2C[C@@H](O)[C@@H](c2ccc(O)c(O)c2)O3)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Davalliaceae | Davallia griffithiana | Ref. |
| Plantae | Davalliaceae | Davallia mariesii | Ref. |
| Plantae | Hypericaceae | Hypericum erectum Thunb. | Ref. |
|
|
zoom in
| Organism | Davallia mariesii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Cui,Chem.Pharm.Bull.,40,(1992),2035 |
|---|
|