| Name |
(-)-Catechin ent-Catechin |
| Formula |
C15H14O6 |
| Mw |
290.07903818 |
| CAS RN |
18829-70-4 |
| C_ID |
C00008808
, 
|
| InChIKey |
PFTAWBLQPZVEMU-UYWMCZCJNA-N |
| InChICode |
InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@@H](c1ccc(O)c(O)c1)[C@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia catechu  | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
| Plantae | Malvaceae | Guazuma ulmifolia  | Ref. |
| Plantae | Polygonaceae | Atraphaxis spinosa | Ref. |
| Plantae | Rhamnaceae | Berchemia formosana | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rosaceae | Chamaebatia foliolosa | Ref. |
| Plantae | Rosaceae | Potentilla fruticosa | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Theaceae | Thea sinensis  | Ref. |
|
|
zoom in
| Organism | Lawsonia inermis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|