| Name |
Padmatin 3-acetate Taxifolin 3-acetate-7-methyl ether |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
100595-93-5 |
| C_ID |
C00008744
, 
|
| InChIKey |
WWYQJKVSCKMFCP-ZVOYONDMNA-N |
| InChICode |
InChI=1S/C18H16O8/c1-8(19)25-18-16(23)15-13(22)6-10(24-2)7-14(15)26-17(18)9-3-4-11(20)12(21)5-9/h3-7,17-18,20-22H,1-2H3/t17-,18+/m0/s1 |
| SMILES |
COc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](OC(C)=O)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chrysothamnus viscidiflorus | Ref. |
| Plantae | Asteraceae | Inula graveolens | Ref. |
| Plantae | Asteraceae | Inula viscosa  | Ref. |
|
|
zoom in
| Organism | Inula graveolens | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 871,Flavanones and dihydroflavonols
Grande,Planta Med.,51,(1985),414
Wollenweber,Phytochem.,30,(1991),2445 |
|---|
|