| Name |
Taxifolin 3'-glucoside Taxifolin 3'-O-glucoside |
| Formula |
C21H22O12 |
| Mw |
466.11112617 |
| CAS RN |
31106-05-5 |
| C_ID |
C00008711
, 
|
| InChIKey |
CZOXIGOPZRIBJM-HSQRCDOUNA-N |
| InChICode |
InChI=1S/C21H22O12/c22-6-13-15(26)17(28)19(30)21(33-13)32-11-3-7(1-2-9(11)24)20-18(29)16(27)14-10(25)4-8(23)5-12(14)31-20/h1-5,13,15,17-26,28-30H,6H2/t13-,15-,17-,18+,19-,20-,21-/m1/s1 |
| SMILES |
O=C1c2c(O)cc(O)cc2O[C@H](c2ccc(O)c(O[C@@H]3OC(CO)[C@@H](O)C(O)C3O)c2)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Thuja orientalis  | Ref. |
| Plantae | Cupressaceae | Thuja plicata | Ref. |
| Plantae | Ericaceae | Erica cinerea | Ref. |
| Plantae | Grossulariaceae | Ribes sanguineum | Ref. |
| Plantae | Pinaceae | Cedrus deodara  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Picea sitchensis  | Ref. |
| Plantae | Pinaceae | Pinus slyvestris | Ref. |
| Plantae | Pinaceae | Pseudotsuga menziesii | Ref. |
|
|
zoom in
| Organism | Thuja plicata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 837,Flavanones and dihydroflavonols
Hergert,J.Org.Chem.23,(1958),700
Lundgren,Phytochem.,27,(1988),829 |
|---|
|