| Name |
6-Prenyleriodictyol |
| Formula |
C20H20O6 |
| Mw |
356.12598837 |
| CAS RN |
80931-12-0 |
| C_ID |
C00008316
, 
|
| InChIKey |
KBEFFXBSHFUQLT-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H20O6/c1-10(2)3-5-12-14(22)8-18-19(20(12)25)16(24)9-17(26-18)11-4-6-13(21)15(23)7-11/h3-4,6-8,17,21-23,25H,5,9H2,1-2H3/t17-/m1/s1 |
| SMILES |
CC(C)=CCc1c(O)cc2c(c1O)C(=O)CC(c1ccc(O)c(O)c1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Wyethia spp. | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza uralensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|