| Name |
Persiconin Persicoside |
| Formula |
C23H26O11 |
| Mw |
478.14751167 |
| CAS RN |
28978-03-2 |
| C_ID |
C00008301
, 
|
| InChIKey |
NKYUUWHIEOUGKB-UHDPYSMHNA-N |
| InChICode |
InChI=1S/C23H26O11/c1-30-11-6-16-19(13(26)8-15(32-16)10-3-4-14(31-2)12(25)5-10)17(7-11)33-23-22(29)21(28)20(27)18(9-24)34-23/h3-7,15,18,20-25,27-29H,8-9H2,1-2H3/t15-,18-,20+,21-,22+,23+/m0/s1 |
| SMILES |
COc1cc2c(c(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c1)C(=O)CC(c1ccc(OC)c(O)c1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Veronica perfoliata | Ref. |
| Plantae | Plantaginaceae | Veronica persica  | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| Plantae | Rosaceae | Prunus sp.  | Ref. |
| Plantae | Rosaceae | Prunus spp.  | Ref. |
| - | - | Persica vulgaris  | Ref. |
|
|
zoom in
| Organism | Veronica persica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|