| Name |
Eriodictyol 7,3'-dimethyl ether |
| Formula |
C17H16O6 |
| Mw |
316.09468824 |
| CAS RN |
54352-60-2 |
| C_ID |
C00008299
, 
|
| InChIKey |
QZJVBGCZOLNWHW-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O6/c1-21-10-6-12(19)17-13(20)8-14(23-16(17)7-10)9-3-4-11(18)15(5-9)22-2/h3-7,14,18-19H,8H2,1-2H3/t14-/m0/s1 |
| SMILES |
COc1cc(O)c2c(c1)OC(c1ccc(O)c(OC)c1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia spp.  | Ref. |
| Plantae | Asteraceae | Brickellia spp. | Ref. |
| Plantae | Asteraceae | Eupatorium spp. | Ref. |
| Plantae | Asteraceae | Hazardia spp. | Ref. |
| Plantae | Rutaceae | Melicope sarcococca | Ref. |
|
|
zoom in
| Organism | Brickellia spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 412,Flavanones and dihydroflavonols
Geissman,Aust.J.Chem.,11,(1958),376 |
|---|
|