| Name |
(2S)-Eriodictyol 7-O-beta-D-glucopyranoside Eriodictyol 7-O-glucoside Miscanthoside |
| Formula |
C21H22O11 |
| Mw |
450.11621155 |
| CAS RN |
38965-51-4 |
| C_ID |
C00008291
, 
|
| InChIKey |
RAFHNDRXYHOLSH-UYIAGQEGNA-N |
| InChICode |
InChI=1S/C21H22O11/c22-7-16-18(27)19(28)20(29)21(32-16)30-9-4-12(25)17-13(26)6-14(31-15(17)5-9)8-1-2-10(23)11(24)3-8/h1-5,14,16,18-25,27-29H,6-7H2/t14-,16+,18+,19-,20+,21+/m0/s1 |
| SMILES |
O=C1CC(c2ccc(O)c(O)c2)Oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Balanophoraceae | Lophophytum spp. | Ref. |
| Plantae | Labiatae | Elsholtzia bodinieri | Ref. |
| Plantae | Labiatae | Mentha aquatica  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Poaceae | Miscanthus sinensis | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Rosaceae | Pyrus communis  | Ref. |
| Plantae | Santalaceae | Viscum coloratum (KOMAR) NAKAI  | Ref. |
|
|
zoom in
| Organism | Lophophytum spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 399,Flavanones and dihydroflavonols
Weinges,Phytochem.,10,(1971),829 |
|---|
|