| Name |
Bavachin |
| Formula |
C20H20O4 |
| Mw |
324.13615913 |
| CAS RN |
19879-32-4 |
| C_ID |
C00008247
, 
|
| InChIKey |
OAUREGNZECGNQS-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H20O4/c1-12(2)3-4-14-9-16-18(23)11-19(24-20(16)10-17(14)22)13-5-7-15(21)8-6-13/h3,5-10,19,21-22H,4,11H2,1-2H3/t19-/m0/s1 |
| SMILES |
CC(C)=CCc1cc2c(cc1O)OC(c1ccc(O)cc1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
|
|
zoom in
| Organism | Psoralea corylifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 354,Flavanones and dihydroflavonols
Bhalla,Tetrahedron Lett.,(1968),2401 |
|---|
|