| Name |
8-Prenylnaringenin (-)-8-Prenylnaringenin Sophoraflavanone B |
| Formula |
C20H20O5 |
| Mw |
340.13107375 |
| CAS RN |
53846-50-7 |
| C_ID |
C00008245
, 
|
| InChIKey |
LPEPZZAVFJPLNZ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H20O5/c1-11(2)3-8-14-15(22)9-16(23)19-17(24)10-18(25-20(14)19)12-4-6-13(21)7-5-12/h3-7,9,18,21-23H,8,10H2,1-2H3/t18-/m0/s1 |
| SMILES |
CC(C)=CCc1c(O)cc(O)c2c1OC(c1ccc(O)cc1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Flourensia riparia Grisebach | Ref. |
| Plantae | Asteraceae | Helichrysum athrixiifolium | Ref. |
| Plantae | Asteraceae | Marshallia grandiflora | Ref. |
| Plantae | Asteraceae | Wyethia helenioides | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Euphorbiaceae | Macaranga conifera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora moorcroftiana  | Ref. |
| Plantae | Fabaceae | Sophora tomentosa  | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis  | Ref. |
|
|
zoom in
| Organism | Helichrysum athrixiifolium | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 352,Flavanones and dihydroflavonols
Bohlmann,Phytochem.,18,(1979),1246
Shirataki,Chem.Pharm.Bull.,33,(1985),444 |
|---|
|