| Name |
Poriol |
| Formula |
C16H14O5 |
| Mw |
286.08412356 |
| CAS RN |
14348-16-4 |
| C_ID |
C00008237
, 
|
| InChIKey |
SLFZBNOERHGNMI-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O5/c1-8-11(18)6-14-15(16(8)20)12(19)7-13(21-14)9-2-4-10(17)5-3-9/h2-6,13,17-18,20H,7H2,1H3/t13-/m0/s1 |
| SMILES |
Cc1c(O)cc2c(c1O)C(=O)CC(c1ccc(O)cc1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Leucothoe keiskei | Ref. |
| Plantae | Pinaceae | Pseudotsuga menziesii | Ref. |
| Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
|
|
zoom in
| Organism | Pseudotsuga menziesii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 343,Flavanones and dihydroflavonols
Viswanathan,Indian J.Chem.Sect.B.,14,(1976),644 |
|---|
|