| Name |
Naringenin 7,4'-dimethyl ether |
| Formula |
C17H16O5 |
| Mw |
300.09977362 |
| CAS RN |
29424-96-2 |
| C_ID |
C00008226
, 
|
| InChIKey |
CKEXCBVNKRHAMX-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O5/c1-20-11-5-3-10(4-6-11)15-9-14(19)17-13(18)7-12(21-2)8-16(17)22-15/h3-8,15,18H,9H2,1-2H3/t15-/m0/s1 |
| SMILES |
COc1ccc(C2CC(=O)c3c(O)cc(OC)cc3O2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Dahlia spp. | Ref. |
| Plantae | Asteraceae | Eupatorium spp. | Ref. |
| Plantae | Asteraceae | Hieracium spp. | Ref. |
| Plantae | Asteraceae | Tessaria dodoneifolia | Ref. |
| Plantae | Betulaceae | Betula spp. | Ref. |
| Plantae | Cactaceae | Mammillaria elongata | Ref. |
| Plantae | Cactaceae | Rhodocactus grandifolius | Ref. |
|
|
zoom in
| Organism | Eupatorium spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 333,Flavanones and dihydroflavonols
Wollenweber,Z.Pflanzenphysiol.,65,(1971),427 |
|---|
|