| Name |
(-)-7,4'-Dihydroxy-5-methoxyflavanone 7,4'-Dihydroxy-5-methoxyflavanone Naringenin 5-O-methyl ether Naringenin 5-methyl ether 5-O-Methylnaringenin |
| Formula |
C16H14O5 |
| Mw |
286.08412356 |
| CAS RN |
61775-19-7 |
| C_ID |
C00008225
, 
|
| InChIKey |
CWZLMWSCLBFCBY-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O5/c1-20-14-6-11(18)7-15-16(14)12(19)8-13(21-15)9-2-4-10(17)5-3-9/h2-7,13,17-18H,8H2,1H3/t13-/m1/s1 |
| SMILES |
COc1cc(O)cc2c1C(=O)CC(c1ccc(O)cc1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achyrocline flaccida | Ref. |
| Plantae | Asteraceae | Gnaphalium multiceps  | Ref. |
| Plantae | Zingiberaceae | Alpinia blepharocalyx  | Ref. |
| Plantae | Zingiberaceae | Alpinia pinnanensis | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia rotunda (LINN.) MANSF.  | Ref. |
|
|
zoom in
| Organism | Gnaphalium multiceps | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 332,Flavanones and dihydroflavonols
Maruyama,Phytohcem.,13,(1974),286 |
|---|
|