| Name |
(+)-6,8-Di-C-methylpinocembrin 5-methyl ether |
| Formula |
C18H18O4 |
| Mw |
298.12050906 |
| CAS RN |
83247-72-7 |
| C_ID |
C00008180
, 
|
| InChIKey |
QKZDDOUPWXQRIK-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C18H18O4/c1-10-16(20)11(2)18-15(17(10)21-3)13(19)9-14(22-18)12-7-5-4-6-8-12/h4-8,14,20H,9H2,1-3H3/t14-/m0/s1 |
| SMILES |
COc1c(C)c(O)c(C)c2c1C(=O)CC(c1ccccc1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Uvaria angolensis | Ref. |
| Plantae | Myrtaceae | Cleistocalyx operculatus  | Ref. |
| Plantae | Myrtaceae | Eugenia javanica | Ref. |
| Plantae | Myrtaceae | Syzygium samarangense | Ref. |
|
|
zoom in
| Organism | Cleistocalyx operculatus |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 276,Flavanones and dihydroflavonols
Hufford,J.Nat.Prod.,45,(1982),337 |
|---|
|
