| Name |
Isoglabranin 6-Prenylpinocembrin 6-Prenylpinocembrin 5,7-Dihydroxy-6-C-prenylflavanone |
| Formula |
C20H20O4 |
| Mw |
324.13615913 |
| CAS RN |
55051-77-9 |
| C_ID |
C00008171
, 
|
| InChIKey |
UOWOIGNEFLTNAW-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H20O4/c1-12(2)8-9-14-15(21)10-18-19(20(14)23)16(22)11-17(24-18)13-6-4-3-5-7-13/h3-8,10,17,21,23H,9,11H2,1-2H3/t17-/m1/s1 |
| SMILES |
CC(C)=CCc1c(O)cc2c(c1O)C(=O)CC(c1ccccc1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum forskahlii  | Ref. |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Fabaceae | Deguelia rariflora | Ref. |
| Plantae | Fabaceae | Derris spp. | Ref. |
| Plantae | Fabaceae | Eysenhardtia platycarpa | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Lonchocarpus floribundus  | Ref. |
| Plantae | Moraceae | Chlorophora tinctoria | Ref. |
| Plantae | Moraceae | Ficus formosana | Ref. |
|
|
zoom in
| Organism | Helichrysum spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 266,Flavanones and dihydroflavonols
Braz Filho,Phytochem.,14,(1975),261 |
|---|
|