| Name |
8-Methylpinocembrin (2S)-8-Methylpinocembrin 8-C-Methylpinocembrin Cryptostrobin |
| Formula |
C16H14O4 |
| Mw |
270.08920894 |
| CAS RN |
55743-21-0 |
| C_ID |
C00008166
, 
|
| InChIKey |
QSRIZZQWNHKERT-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O4/c1-9-11(17)7-12(18)15-13(19)8-14(20-16(9)15)10-5-3-2-4-6-10/h2-7,14,17-18H,8H2,1H3/t14-/m0/s1 |
| SMILES |
Cc1c(O)cc(O)c2c1OC(c1ccccc1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Ceratiola ericoides | Ref. |
| Plantae | Myricaceae | Comptonia peregrina  | Ref. |
| Plantae | Myrtaceae | Kunzea ambigua | Ref. |
| Plantae | Myrtaceae | Syzygium samarangense | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Thelypteridaceae | Thelypteris palustris | Ref. |
|
|
zoom in
| Organism | Comptonia peregrina | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 261,Flavanones and dihydroflavonols
Lindstedt,Acata Chem.Scand.,5,(1951),1 |
|---|
|