| Name |
Sanggenon O |
| Formula |
C40H36O12 |
| Mw |
708.22067662 |
| CAS RN |
101664-32-8 |
| C_ID |
C00008107
, 
|
| InChIKey |
LHPRLOAEYJFDCW-NPFGZEBFNA-N |
| InChICode |
InChI=1S/C40H36O12/c1-18(2)10-11-39-38(49)35-31(47)17-30(46)34(37(35)52-40(39,50)27-9-6-22(43)16-32(27)51-39)26-13-19(3)12-25(23-7-4-20(41)14-28(23)44)33(26)36(48)24-8-5-21(42)15-29(24)45/h4-10,13-17,25-26,33,41-47,50H,11-12H2,1-3H3/t25-,26+,33-,39-,40+/m1/s1 |
| SMILES |
CC(C)=CCC12Oc3cc(O)ccc3C1(O)Oc1c(c(O)cc(O)c1[C@H]1C=C(C)C[C@H](c3ccc(O)cc3O)[C@H]1C(=O)c1ccc(O)cc1O)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus cathayana | Ref. |
| Plantae | Moraceae | Morus mongolica  | Ref. |
|
|
zoom in
| Organism | Morus cathayana | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Shen, et al., Phytochemistry, 57, (2001), 1231 |
|---|
|