| Name |
Uvangoletin |
| Formula |
C16H16O4 |
| Mw |
272.104859 |
| CAS RN |
76444-56-9 |
| C_ID |
C00007930
, 
|
| InChIKey |
FYPYWIYWMVCNCS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H16O4/c1-20-15-10-12(17)9-14(19)16(15)13(18)8-7-11-5-3-2-4-6-11/h2-6,9-10,17,19H,7-8H2,1H3 |
| SMILES |
COc1cc(O)cc(O)c1C(=O)CCc1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Uvaria acuminata  | Ref. |
| Plantae | Annonaceae | Uvaria angolensis | Ref. |
| Plantae | Myrtaceae | Syzygium samarangense | Ref. |
| - | - | uvaria angolensis | Ref. |
|
|
zoom in
| Organism | Uvaria angolensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Hufford,Phytochem.,19,(1980),2036 |
|---|
|