| Name |
(+)-Taxiresinol Taxiresinol |
| Formula |
C19H22O6 |
| Mw |
346.14163844 |
| CAS RN |
40951-69-7 |
| C_ID |
C00007200
, 
|
| InChIKey |
SNZZAHRDXCGWEM-BTRUBGRANA-N |
| InChICode |
InChI=1S/C19H22O6/c1-24-18-7-11(2-4-16(18)22)6-13-10-25-19(14(13)9-20)12-3-5-15(21)17(23)8-12/h2-5,7-8,13-14,19-23H,6,9-10H2,1H3/t13-,14-,19+/m0/s1 |
| SMILES |
COc1cc(C[C@H]2CO[C@H](c3ccc(O)c(O)c3)[C@H]2CO)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Taxaceae | Taxus buccata | Ref. |
| Plantae | Taxaceae | Taxus cuspidata  | Ref. |
| Plantae | Taxaceae | Taxus mairei  | Ref. |
| Plantae | Taxaceae | Taxus wallichiana  | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| Plantae | Thymelaeaceae | Daphne oleoides spp.  | Ref. |
|
|
zoom in
| Organism | Taxus buccata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|