| Name |
Lucidone |
| Formula |
C15H12O4 |
| Mw |
256.07355887 |
| CAS RN |
19956-53-7 |
| C_ID |
C00007169
, 
|
| InChIKey |
WVXIJNYYNKDLPE-UWWXTLEHSA-N |
| InChICode |
InChI=1S/C15H12O4/c1-19-13-9-12(17)14(15(13)18)11(16)8-7-10-5-3-2-4-6-10/h2-9,16H,1H3/b8-7+,14-11- |
| SMILES |
COC1=CC(=O)/C(=C(O)C=Cc2ccccc2)C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lauraceae | Lindera erythrocarpa | Ref. |
| Plantae | Lauraceae | Lindera lucida | Ref. |
| Plantae | Lauraceae | Lindera pipericarpa | Ref. |
|
|
zoom in
| Organism | Lindera lucida | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Lee,Tetrahedron Lett.,(1968),4243
Lee,J.Chem.Soc.Perkin Trans,1,(1985),453 |
|---|
|