| Name |
Derricin |
| Formula |
C21H22O3 |
| Mw |
322.15689457 |
| CAS RN |
38965-77-4 |
| C_ID |
C00007052
, 
|
| InChIKey |
HMGRVRIPKPTWTO-JLHYYAGUSA-N |
| InChICode |
InChI=1S/C21H22O3/c1-15(2)9-11-18-20(24-3)14-12-17(21(18)23)19(22)13-10-16-7-5-4-6-8-16/h4-10,12-14,23H,11H2,1-3H3/b13-10+ |
| SMILES |
COc1ccc(C(=O)/C=C/c2ccccc2)c(O)c1CC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Derris sericea | Ref. |
| Plantae | Fabaceae | Lonchocarpus neuroscapha | Ref. |
| Plantae | Fabaceae | Lonchocarpus nitidus | Ref. |
|
|
zoom in
| Organism | Lonchocarpus neuroscapha | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
do Nascimento,An.Acad.Brasil.Cienc.,42,(1970),(suppl.),87
do Nascimento,Phytochem.,11,(1972),3023 |
|---|
|