| Name |
Pedicellin |
| Formula |
C20H22O6 |
| Mw |
358.14163844 |
| CAS RN |
518-58-1 |
| C_ID |
C00006986
, 
|
| InChIKey |
BHTMJPHRPUKDBL-VAWYXSNFSA-N |
| InChICode |
InChI=1S/C20H22O6/c1-22-16-15(14(21)12-11-13-9-7-6-8-10-13)17(23-2)19(25-4)20(26-5)18(16)24-3/h6-12H,1-5H3/b12-11+ |
| SMILES |
COc1c(OC)c(OC)c(C(=O)/C=C/c2ccccc2)c(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Gentianaceae | Gentiana pedicellata | Ref. |
| Plantae | Gesneriaceae | Didymocarpus pedicellata  | Ref. |
| Plantae | Lauraceae | Lindera lucida | Ref. |
|
|
zoom in
| Organism | Didymocarpus pedicellata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Agarwal,Indian J.Chem.,11,(1973),9
Seshadri,Rev.Pur Appl.Chem.,1,(1951),186 |
|---|
|