| Name |
Homobutein |
| Formula |
C16H14O5 |
| Mw |
286.08412356 |
| CAS RN |
34000-39-0 |
| C_ID |
C00006942
, 
|
| InChIKey |
BWFSBUVPIAIXKJ-QHHAFSJGSA-N |
| InChICode |
InChI=1S/C16H14O5/c1-21-16-8-10(3-7-14(16)19)2-6-13(18)12-5-4-11(17)9-15(12)20/h2-9,17,19-20H,1H3/b6-2+ |
| SMILES |
COc1cc(/C=C/C(=O)c2ccc(O)cc2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Tithonia fruticosa | Ref. |
| Plantae | Fabaceae | Acacia kempeana  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum  | Ref. |
| Plantae | Myristicaceae | Iryanthera polyneura | Ref. |
|
|
zoom in
| Organism | Acacia kempeana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Wong,Phytochem.,7,(1968),2123
de Almeida,Phytochem.,18,(1979),1015 |
|---|
|