| Name |
Cardamomin |
| Formula |
C16H14O4 |
| Mw |
270.08920894 |
| CAS RN |
19309-14-9 |
| C_ID |
C00006935
, 
|
| InChIKey |
NYSZJNUIVUBQMM-BQYQJAHWSA-N |
| InChICode |
InChI=1S/C16H14O4/c1-20-15-10-12(17)9-14(19)16(15)13(18)8-7-11-5-3-2-4-6-11/h2-10,17,19H,1H3/b8-7+ |
| SMILES |
COc1cc(O)cc(O)c1C(=O)/C=C/c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum forskahlii  | Ref. |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Lauraceae | Lindera umbellata  | Ref. |
| Plantae | Piperaceae | Piper aduncum  | Ref. |
| Plantae | Piperaceae | Piper hispidum  | Ref. |
| Plantae | Pteridaceae | Pityrogramma chrysophylla  | Ref. |
| Plantae | Pteridaceae | Pityrogramma tartarea | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Woodsiaceae/Dryopteridaceae | Woodsia scopulina | Ref. |
| Plantae | Zingiberaceae | Alpinia mutica  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia rotunda (LINN.) MANSF.  | Ref. |
|
|
zoom in
| Organism | Helichrysum spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Sauer,Planta Med.,15,(1967),332
Kimura,Yakugaku Zasshi,88,(1968),239 |
|---|
|