| Name |
Violanin Delphinidin 3-[6-(4-(E)-p-coumarylrhamnosyl)glucoside]-5-glucoside |
| Formula |
C42H47O23 |
| Mw |
919.25081281 |
| CAS RN |
28463-30-1,108266-61-1 |
| C_ID |
C00006893
, 
|
| InChIKey |
YLRJRFOZRJMCAN-UHFFFAOYNA-O |
| InChICode |
InChI=1S/C42H46O23/c1-15-38(65-28(48)7-4-16-2-5-18(44)6-3-16)34(54)37(57)40(59-15)58-14-27-31(51)33(53)36(56)42(64-27)62-25-12-20-23(60-39(25)17-8-21(46)29(49)22(47)9-17)10-19(45)11-24(20)61-41-35(55)32(52)30(50)26(13-43)63-41/h2-12,15,26-27,30-38,40-43,50-57H,13-14H2,1H3,(H4-,44,45,46,47,48,49)/p+1/t15-,26+,27-,30+,31+,32-,33-,34+,35-,36+,37+,38-,40+,41+,42+/m0/s1 |
| SMILES |
CC1OC(OCC2OC(Oc3cc4c(OC5OC(CO)C(O)C(O)C5O)cc(O)cc4[o+]c3-c3cc(O)c(O)c(O)c3)C(O)C(O)C2O)C(O)C(O)C1OC(=O)/C=C/c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Iridaceae | Iris tingitana | Ref. |
| Plantae | Solanaceae | Petunia x hybrida | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum melongena  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Violaceae | Viola tricolor  | Ref. |
|
|
zoom in
| Organism | Petunia x hybrida | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Goto,Tetrahedron Lett.,(1978),2413
Schram,Z.Naturforsch.C.,38,(1983),342 |
|---|
|