| Name |
Peonidin 3-(6''-malonylglucoside) |
| Formula |
C25H25O14 |
| Mw |
549.12443051 |
| CAS RN |
122856-11-5 |
| C_ID |
C00006860
, 
|
| InChIKey |
CKJPGRXYFVEMFF-GHQQAVPNNA-O |
| InChICode |
InChI=1S/C25H24O14/c1-35-16-4-10(2-3-13(16)27)24-17(7-12-14(28)5-11(26)6-15(12)37-24)38-25-23(34)22(33)21(32)18(39-25)9-36-20(31)8-19(29)30/h2-7,18,21-23,25,32-34H,8-9H2,1H3,(H3-,26,27,28,29,30)/p+1/t18-,21+,22+,23-,25-/m1/s1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O[C@@H]2OC(COC(=O)CC(=O)O)[C@@H](O)C(O)C2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Malvaceae | Hibiscus syriacus  | Ref. |
| Plantae | Poaceae | Alopecurus spp. | Ref. |
| Plantae | Poaceae | Anthoxanthum spp. | Ref. |
| Plantae | Poaceae | Avenula spp. | Ref. |
| Plantae | Poaceae | Bothriochloa spp. | Ref. |
| Plantae | Poaceae | Dactylis spp. | Ref. |
| Plantae | Poaceae | Deschampsia spp. | Ref. |
| Plantae | Poaceae | Elymus spp. | Ref. |
| Plantae | Poaceae | Festuca spp. | Ref. |
| Plantae | Poaceae | Hordeum spp. | Ref. |
| Plantae | Poaceae | Miscanthus spp. | Ref. |
| Plantae | Poaceae | Molinia spp. | Ref. |
| Plantae | Poaceae | Oryza spp. | Ref. |
| Plantae | Poaceae | Phalaris spp. | Ref. |
| Plantae | Poaceae | Phleum spp. | Ref. |
| Plantae | Poaceae | Poa spp. | Ref. |
| Plantae | Poaceae | Sinarundinaria spp. | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
|
|
zoom in
| Organism | Hibiscus syriacus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Kim,Phytochem.,28,(1989),1503 |
|---|
|