| Name |
Monodemalonylmonardaein |
| Formula |
C39H39O20 |
| Mw |
827.20346869 |
| CAS RN |
101205-00-9 |
| C_ID |
C00006774
, 
|
| InChIKey |
SVWGZAOFZPHNJL-NZGPRJMWNA-O |
| InChICode |
InChI=1S/C39H38O20/c40-19-6-1-17(2-7-19)3-10-29(45)53-15-26-31(47)34(50)36(52)39(59-26)57-25-13-22-23(55-37(25)18-4-8-20(41)9-5-18)11-21(42)12-24(22)56-38-35(51)33(49)32(48)27(58-38)16-54-30(46)14-28(43)44/h1-13,26-27,31-36,38-39,47-52H,14-16H2,(H3-,40,41,42,43,44,45)/p+1/t26-,27+,31-,32-,33+,34+,35-,36-,38-,39-/m1/s1 |
| SMILES |
O=C(O)CC(=O)OCC1O[C@@H](Oc2cc(O)cc3[o+]c(-c4ccc(O)cc4)c(O[C@@H]4OC(COC(=O)/C=C/c5ccc(O)cc5)[C@@H](O)C(O)C4O)cc23)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Hyacinthaceae | Hyacinthus officinalis | Ref. |
| Plantae | Labiatae | Agastache aurantiaca | Ref. |
| Plantae | Labiatae | Hyptis eriocephala | Ref. |
| Plantae | Labiatae | Monarda didyma  | Ref. |
| Plantae | Labiatae | Salvia coccinea  | Ref. |
| Plantae | Labiatae | Salvia greggii | Ref. |
| Plantae | Labiatae | Salvia splendens | Ref. |
| Plantae | Labiatae | Stachys officinalis  | Ref. |
|
|
zoom in
| Organism | Agastache aurantiaca | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Kondo,Tetrahedron Lett.,26,(1985),5879
Kondo,Tetrahedron Lett.,30,(1989),6729 |
|---|
|