| Name |
Delphinidin 3-rhamnoside |
| Formula |
C21H21O11 |
| Mw |
449.10838652 |
| CAS RN |
29907-19-5 |
| C_ID |
C00006699
, 
|
| InChIKey |
JDZRKJMABULBJY-FLKJPZOLNA-O |
| InChICode |
InChI=1S/C21H20O11/c1-7-16(26)18(28)19(29)21(30-7)32-15-6-10-11(23)4-9(22)5-14(10)31-20(15)8-2-12(24)17(27)13(25)3-8/h2-7,16,18-19,21,26,28-29H,1H3,(H4-,22,23,24,25,27)/p+1/t7-,16+,18+,19+,21+/m1/s1 |
| SMILES |
CC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2cc(O)c(O)c(O)c2)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Vaccinium padifolium | Ref. |
| Plantae | Fabaceae | Lathyrus odoratus  | Ref. |
| Plantae | Labiatae | Salvia spp.  | Ref. |
| Plantae | Myrtaceae | Thryptomene maisonneuvii | Ref. |
| Plantae | Plumbaginaceae | Plumbago rosea | Ref. |
| Plantae | Vitaceae | Cissus sicyoides  | Ref. |
|
|
zoom in
| Organism | Lathyrus odoratus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Phytochem.,2,(1963),85 |
|---|
|