| Name |
Delphinidin 3-arabinoside Delphinidin-3-O-arabinoside |
| Formula |
C20H19O11 |
| Mw |
435.09273645 |
| CAS RN |
28500-01-8 |
| C_ID |
C00006696
, 
|
| InChIKey |
XZUBZVMZVWFBNE-CRJFCAEUNA-O |
| InChICode |
InChI=1S/C20H18O11/c21-8-3-10(22)9-5-15(31-20-18(28)17(27)13(25)6-29-20)19(30-14(9)4-8)7-1-11(23)16(26)12(24)2-7/h1-5,13,17-18,20,25,27-28H,6H2,(H4-,21,22,23,24,26)/p+1/t13-,17+,18-,20-/m0/s1 |
| SMILES |
Oc1cc(O)c2cc(O[C@@H]3OC[C@H](O)C(O)C3O)c(-c3cc(O)c(O)c(O)c3)[o+]c2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Carthamus glauca | Ref. |
| Plantae | Ericaceae | Acrotriche serrulata | Ref. |
| Plantae | Ericaceae | Empetrum nigrum  | Ref. |
| Plantae | Ericaceae | Epacris gunnii | Ref. |
| Plantae | Ericaceae | Leucopogon collinus | Ref. |
| Plantae | Ericaceae | Pentachondra ericaefolia | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Ericaceae | Trochocarpa spp. | Ref. |
| Plantae | Ericaceae | Vaccinium angustifolium  | Ref. |
| Plantae | Ericaceae | Vaccinium arboreum | Ref. |
| Plantae | Ericaceae | Vaccinium padifolium | Ref. |
| Plantae | Ericaceae | Vaccinium spp. | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
|
|
zoom in
| Organism | Acrotriche serrulata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Francis,J.Food Sci.,31,(1966),583
Jarman,Phytochem.,10,(1971),2235 |
|---|
|