| Name |
Cyanidin 3-arabinoside |
| Formula |
C20H19O10 |
| Mw |
419.09782183 |
| CAS RN |
57186-11-5 |
| C_ID |
C00006650
, 
|
| InChIKey |
KUCVMQMKRICXJC-CXVATLBVNA-O |
| InChICode |
InChI=1S/C20H18O10/c21-9-4-12(23)10-6-16(30-20-18(27)17(26)14(25)7-28-20)19(29-15(10)5-9)8-1-2-11(22)13(24)3-8/h1-6,14,17-18,20,25-27H,7H2,(H3-,21,22,23,24)/p+1/t14-,17+,18+,20+/m1/s1 |
| SMILES |
Oc1cc(O)c2cc(O[C@@H]3OC[C@H](O)C(O)C3O)c(-c3ccc(O)c(O)c3)[o+]c2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Ericaceae | Acrotriche serrulata | Ref. |
| Plantae | Ericaceae | Empetrum nigrum  | Ref. |
| Plantae | Ericaceae | Epacris gunnii | Ref. |
| Plantae | Ericaceae | Gaylussacia spp. | Ref. |
| Plantae | Ericaceae | Leucopogon collinus | Ref. |
| Plantae | Ericaceae | Rhododendron spp. | Ref. |
| Plantae | Ericaceae | Vaccinium padifolium | Ref. |
| Plantae | Ericaceae | Vaccinium spp. | Ref. |
| Plantae | Malvaceae | Sterculia parviflora | Ref. |
| Plantae | Malvaceae | Theobroma cacao  | Ref. |
| Plantae | Plantaginaceae | Penstemon spp. | Ref. |
| Plantae | Poaceae | Phalaris arundinacea | Ref. |
| Plantae | Polygonaceae | Polygonum spp. | Ref. |
| Plantae | Rosaceae | Aronia melanocarpa  | Ref. |
| Plantae | Rosaceae | Malus sylvestris  | Ref. |
| Plantae | Rubiaceae | Cinchona ledgeriana | Ref. |
| Plantae | Saxifragaceae | Saxifraga spp. | Ref. |
| Plantae | Theaceae | Camellia japonica  | Ref. |
|
|
zoom in
| Organism | Acrotriche serrulata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Forsyth,Biochem.J.,65,(1957),177
Zapsalis,J.Food Sci.,30,(1965),396 |
|---|
|