| Name |
Pelargonidin 3-rutinoside-5-glucoside |
| Formula |
C33H41O19 |
| Mw |
741.22420413 |
| CAS RN |
62058-43-9 |
| C_ID |
C00006648
, 
|
| InChIKey |
YTMOEUVNNYCFEO-MMKVXARMNA-O |
| InChICode |
InChI=1S/C33H40O19/c1-11-21(37)24(40)27(43)31(47-11)46-10-20-23(39)26(42)29(45)33(52-20)50-18-8-15-16(48-30(18)12-2-4-13(35)5-3-12)6-14(36)7-17(15)49-32-28(44)25(41)22(38)19(9-34)51-32/h2-8,11,19-29,31-34,37-45H,9-10H2,1H3,(H-,35,36)/p+1/t11-,19-,20+,21-,22+,23+,24-,25-,26-,27-,28-,29+,31+,32+,33+/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3cc4c(O[C@@H]5OC(CO)[C@@H](O)[C@H](O)C5O)cc(O)cc4[o+]c3-c3ccc(O)cc3)C(O)C(O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bromeliaceae | Billbergia buchholtzii | Ref. |
| Plantae | Caryophyllaceae | Silene dioica | Ref. |
| Plantae | Fabaceae | Trifolium medium | Ref. |
| Plantae | Gesneriaceae | Achimenes spp. | Ref. |
| Plantae | Gesneriaceae | Dichrotrichum sp. | Ref. |
| Plantae | Gesneriaceae | Saintpaulia ionantha | Ref. |
| Plantae | Gesneriaceae | Streptocarpus spp. | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
|
|
zoom in
| Organism | Silene dioica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Harborne,Phytochem.,2,(1963),85
Saito,Phytochem.,22,(1983),1735 |
|---|
|