| Name |
Isocryptomerin |
| Formula |
C31H20O10 |
| Mw |
552.10564686 |
| CAS RN |
20931-58-2 |
| C_ID |
C00006535
, 
|
| InChIKey |
PTKBMDRXKOIHCA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C31H20O10/c1-38-27-14-26-29(22(36)13-24(41-26)15-2-6-17(32)7-3-15)30(37)31(27)39-19-8-4-16(5-9-19)23-12-21(35)28-20(34)10-18(33)11-25(28)40-23/h2-14,32-34,37H,1H3 |
| SMILES |
COc1cc2oc(-c3ccc(O)cc3)cc(=O)c2c(O)c1Oc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Chamaecyparis obtusa | Ref. |
| Plantae | Cupressaceae | Chamaecyparis pisifera | Ref. |
| Plantae | Cupressaceae | Cupressus cashmeriana | Ref. |
| Plantae | Cupressaceae | Cupressus funebris | Ref. |
| Plantae | Cupressaceae | Cupressus sempervirens  | Ref. |
| Plantae | Cupressaceae | Fitzroya patagonica | Ref. |
| Plantae | Cupressaceae | Juniperus spp. | Ref. |
| Plantae | Fagaceae | Quercus infectoria  | Ref. |
| Plantae | Taxodiaceae | Glyptostrobus lineatus | Ref. |
| Plantae | Taxodiaceae | Metasequoia glyptostroboides | Ref. |
| Plantae | Taxodiaceae | Taiwania spp. | Ref. |
| Plantae | Taxodiaceae | Taxodium distichum | Ref. |
| Plantae | Taxodiaceae | Taxodium mucronatum | Ref. |
| - | - | Selaginella tamariscina  | Ref. |
|
|
zoom in
| Organism | Chamaecyparis pisifera | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Miura,Tetrahedron Lett.,(1968),2339 |
|---|
|