| Name |
Tetrahydroamentoflavone |
| Formula |
C30H22O10 |
| Mw |
542.12129692 |
| CAS RN |
72149-91-8 |
| C_ID |
C00006516
, 
|
| InChIKey |
ULTQJSQDLWNWTR-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C30H22O10/c31-15-4-1-13(2-5-15)24-12-23(38)29-21(36)10-20(35)27(30(29)40-24)17-7-14(3-6-18(17)33)25-11-22(37)28-19(34)8-16(32)9-26(28)39-25/h1-10,24-25,31-36H,11-12H2/t24-,25-/m1/s1 |
| SMILES |
O=C1CC(c2ccc(O)c(-c3c(O)cc(O)c4c3OC(c3ccc(O)cc3)CC4=O)c2)Oc2cc(O)cc(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Schinus terebinthifolius  | Ref. |
| Plantae | Anacardiaceae | Semecarpus anacardium  | Ref. |
| Plantae | Anacardiaceae | Toxicodendron radicans | Ref. |
| Plantae | Ochnaceae | Ochna pumila | Ref. |
|
|
zoom in
| Organism | Semecarpus anacardium | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Ishratullah,Indian J.Chem.Sect.B.,15,(1977),615
El-Sohly,Phytochem.,17,(1978),2140 |
|---|
|