| Name |
Rhusflavanone |
| Formula |
C30H22O10 |
| Mw |
542.12129692 |
| CAS RN |
53060-72-3 |
| C_ID |
C00006458
, 
|
| InChIKey |
YBDIZQWDBBOOFB-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C30H22O10/c31-15-5-1-13(2-6-15)22-11-20(36)26-24(39-22)12-21(37)27(29(26)38)28-18(34)9-17(33)25-19(35)10-23(40-30(25)28)14-3-7-16(32)8-4-14/h1-9,12,22-23,31-34,37-38H,10-11H2/t22-,23+/m1/s1 |
| SMILES |
O=C1CC(c2ccc(O)cc2)Oc2cc(O)c(-c3c(O)cc(O)c4c3OC(c3ccc(O)cc3)CC4=O)c(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus succedanea  | Ref. |
| Plantae | Anacardiaceae | Rhus sylvestris | Ref. |
|
|
zoom in
| Organism | Rhus sylvestris |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
