| Name |
3-8'-Biapigenin 3,8''-Biapigenin |
| Formula |
C30H18O10 |
| Mw |
538.0899968 |
| CAS RN |
101140-06-1 |
| C_ID |
C00006431
, 
|
| InChIKey |
IQAMTZLKUHMPPE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C30H18O10/c31-15-5-1-13(2-6-15)22-12-21(37)24-19(35)11-20(36)26(30(24)39-22)27-28(38)25-18(34)9-17(33)10-23(25)40-29(27)14-3-7-16(32)8-4-14/h1-12,31-36H |
| SMILES |
O=c1c(-c2c(O)cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia kola  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia livingstonii | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xanthochymus  | Ref. |
| Plantae | Hypericaceae | Hypericum aucheri | Ref. |
| Plantae | Hypericaceae | Hypericum maculatum  | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum  | Ref. |
| Plantae | Hypericaceae | Hypericum thasium | Ref. |
| Plantae | Polygonaceae | Fagopyrum esculentum  | Ref. |
|
|
zoom in
| Organism | Garcinia kola | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|