| Name |
Vicenin 3 |
| Formula |
C26H28O14 |
| Mw |
564.14790561 |
| CAS RN |
59914-91-9 |
| C_ID |
C00006380
, 
|
| InChIKey |
MMDUKUSNQNWVET-HVWMPVMFNA-N |
| InChICode |
InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)15-19(33)14-10(29)5-12(8-1-3-9(28)4-2-8)39-24(14)16(20(15)34)25-22(36)17(31)11(30)7-38-25/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13-,17-,18-,21+,22-,23-,25-,26+/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2c([C@@H]3OC[C@@H](O)[C@H](O)C3O)c(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Desmodium styracifolium  | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum | Ref. |
| Plantae | Labiatae | Premna spp. | Ref. |
| Plantae | Labiatae | Vitex lucens | Ref. |
| Plantae | Theaceae | Camellia sinensis | Ref. |
|
|
zoom in
| Organism | Trigonella foenum-graecum |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
