| Name |
4'-O-Methylpuerarin Puerarin 4'-methyl ether |
| Formula |
C22H22O9 |
| Mw |
430.1263823 |
| CAS RN |
92117-94-7 |
| C_ID |
C00006363
, 
|
| InChIKey |
UWRLUNPRLSNXRR-PLAKOYNZNA-N |
| InChICode |
InChI=1S/C22H22O9/c1-29-11-4-2-10(3-5-11)13-9-30-21-12(17(13)25)6-7-14(24)16(21)22-20(28)19(27)18(26)15(8-23)31-22/h2-7,9,15,18-20,22-24,26-28H,8H2,1H3/t15-,18-,19+,20-,22+/m1/s1 |
| SMILES |
COc1ccc(-c2coc3c([C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)c(O)ccc3c2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Pueraria lobata  | Ref. |
| Plantae | Fabaceae | Pueraria sp. | Ref. |
| Plantae | Fabaceae | Pueraria thomsonii  | Ref. |
|
|
zoom in
| Organism | Pueraria sp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Zhang,Chem.Abstr.,101,(1984),137094 |
|---|
|