| Name |
Isovitexin 2''-O-rhamnoside |
| Formula |
C27H30O14 |
| Mw |
578.16355567 |
| CAS RN |
72036-50-1 |
| C_ID |
C00006221
, 
|
| InChIKey |
BGPMMCPSTAYIEL-CYIQVPMQNA-N |
| InChICode |
InChI=1S/C27H30O14/c1-9-19(32)22(35)24(37)27(38-9)41-26-23(36)20(33)16(8-28)40-25(26)18-13(31)7-15-17(21(18)34)12(30)6-14(39-15)10-2-4-11(29)5-3-10/h2-7,9,16,19-20,22-29,31-37H,8H2,1H3/t9-,16+,19-,20+,22-,23-,24+,25-,26+,27-/m0/s1 |
| SMILES |
CC1O[C@@H](OC2[C@@H](O)[C@H](O)C(CO)O[C@H]2c2c(O)cc3oc(-c4ccc(O)cc4)cc(=O)c3c2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Siphonoglossa mexicana | Ref. |
| Plantae | Caryophyllaceae | Melandrium album  | Ref. |
| Plantae | Caryophyllaceae | Silene spp. | Ref. |
| Plantae | Gentianaceae | Tripterospermum japonicum | Ref. |
| Plantae | Oxalidaceae | Biophytum sensitivum  | Ref. |
| Plantae | Rosaceae | Crataegus monogyna  | Ref. |
| Plantae | Sapindaceae | Allophylus edulis | Ref. |
|
|
zoom in
| Organism | Melandrium album | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Chopin,Phytochem.,16,(1977),2041 |
|---|
|