| Name |
8-C-Glucopyranosylgenistein 6''-O-apioside Genistein 8-C-apiosyl-(1->6)-glucopyranoside |
| Formula |
C26H28O14 |
| Mw |
564.14790561 |
| CAS RN |
114240-17-4 |
| C_ID |
C00006193
, 
|
| InChIKey |
HLCONXCNZYLRRC-DNMNFJEWNA-N |
| InChICode |
InChI=1S/C26H28O14/c27-8-26(36)9-39-25(24(26)35)38-7-15-19(32)20(33)21(34)23(40-15)17-14(30)5-13(29)16-18(31)12(6-37-22(16)17)10-1-3-11(28)4-2-10/h1-6,15,19-21,23-25,27-30,32-36H,7-9H2/t15-,19+,20+,21+,23-,24-,25+,26-/m0/s1 |
| SMILES |
O=c1c(-c2ccc(O)cc2)coc2c([C@@H]3O[C@@H](CO[C@@H]4OC[C@@](O)(CO)C4O)[C@@H](O)C(O)C3O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Millettia nitida var.hirsutissima | Ref. |
| Plantae | Fabaceae | Pueraria mirifica  | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
|
|
zoom in
| Organism | Pueraria mirifica | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Kinjo,Chem.Pharm.Bull.,35,(1987),446 |
|---|
|