| Name |
Lucenin 1 |
| Formula |
C26H28O15 |
| Mw |
580.14282023 |
| CAS RN |
35927-39-0 |
| C_ID |
C00006178
, 
|
| InChIKey |
WYYFCTVKFALPQV-HVWMPVMFNA-N |
| InChICode |
InChI=1S/C26H28O15/c27-5-13-18(33)21(36)23(38)26(41-13)16-20(35)15(25-22(37)17(32)11(31)6-39-25)19(34)14-10(30)4-12(40-24(14)16)7-1-2-8(28)9(29)3-7/h1-4,11,13,17-18,21-23,25-29,31-38H,5-6H2/t11-,13-,17-,18-,21+,22-,23-,25-,26+/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)c(O)c2)oc2c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c([C@@H]3OC[C@@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ephedraceae | Ephedra antisyphylitica | Ref. |
| Plantae | Fagaceae | Quercus sp. | Ref. |
| Plantae | Labiatae | Vitex lucens | Ref. |
| Plantae | Plagiochilaceae | Plagiochila asplenioides | Ref. |
|
|
zoom in
| Organism | Quercus sp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Sekil,Tetrahedron Lett.,(1965),1105
Mues,Phytochem.,14,(1975),577 |
|---|
|