| Name |
Isoswertiajaponin 2-(3,4-Dihydroxyphenyl)-8-beta-D-glucopyranosyl-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one |
| Formula |
C22H22O11 |
| Mw |
462.11621155 |
| CAS RN |
6980-41-2 |
| C_ID |
C00006122
, 
|
| InChIKey |
BRYZTZMVXZZLPD-PLAKOYNZNA-N |
| InChICode |
InChI=1S/C22H22O11/c1-31-14-6-12(27)16-11(26)5-13(8-2-3-9(24)10(25)4-8)32-21(16)17(14)22-20(30)19(29)18(28)15(7-23)33-22/h2-6,15,18-20,22-25,27-30H,7H2,1H3/t15-,18-,19+,20-,22+/m1/s1 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccc(O)c(O)c3)oc2c1[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Gnetaceae | Gnetum gnemon  | Ref. |
| Plantae | Iridaceae | Iris florentina | Ref. |
| Plantae | Passifloraceae | Passiflora sexflora | Ref. |
| Plantae | Poaceae | Phragmites australis  | Ref. |
|
|
zoom in
| Organism | Iris florentina | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Wallace,Phytochem.,17,(1978),1809 |
|---|
|