| Name |
Myricetin 3-(3''-galloylrhamnoside) Myricetin-3-O-(3''-O-galloyl)-alpha-L-rhamnopyranoside Myricetin-3-O-(3''-O-galloyl)-alpha-rhamnopyranoside |
| Formula |
C28H24O16 |
| Mw |
616.10643472 |
| CAS RN |
143202-36-2 |
| C_ID |
C00006043
, 
|
| InChIKey |
AHOPFKRXJRLLGF-VSXYVHBANA-N |
| InChICode |
InChI=1S/C28H24O16/c1-8-19(35)25(43-27(40)10-4-15(33)21(37)16(34)5-10)23(39)28(41-8)44-26-22(38)18-12(30)6-11(29)7-17(18)42-24(26)9-2-13(31)20(36)14(32)3-9/h2-8,19,23,25,28-37,39H,1H3/t8-,19-,23-,25+,28-/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2c(-c3cc(O)c(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@@H](O)C(OC(=O)c2cc(O)c(O)c(O)c2)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Pistacia weinmannifolia J.Pisson ex.Franch  | Ref. |
| Plantae | Myricaceae | Myrica esculenta  | Ref. |
| Plantae | Myrtaceae | Syzygium samarangense | Ref. |
| Plantae | Polygonaceae | Polygonum aviculare  | Ref. |
|
|
zoom in
| Organism | Myrica esculenta | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Sun,Linchan Huaxue Yu Gongye,11,(1991),251 |
|---|
|