| Name |
Quercetin 3-(6''-galloylgalactoside) |
| Formula |
C28H24O16 |
| Mw |
616.10643472 |
| CAS RN |
53171-28-1 |
| C_ID |
C00005951
, 
|
| InChIKey |
FMQQLXJREAGPHS-WYKGQUACNA-N |
| InChICode |
InChI=1S/C28H24O16/c29-11-6-14(32)19-17(7-11)42-25(9-1-2-12(30)13(31)3-9)26(22(19)37)44-28-24(39)23(38)21(36)18(43-28)8-41-27(40)10-4-15(33)20(35)16(34)5-10/h1-7,18,21,23-24,28-36,38-39H,8H2/t18-,21+,23+,24-,28+/m1/s1 |
| SMILES |
O=C(OC[C@H]1O[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)[C@H]1O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Tagetes elliptica  | Ref. |
| Plantae | Ericaceae | Arctostaphylos uva-ursi  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia dulcis | Ref. |
| Plantae | Euphorbiaceae | Euphorbia platyphyllos | Ref. |
| Plantae | Lythraceae | Woodfordia fruticosa  | Ref. |
| Plantae | Onagraceae | Epilobium angustifolium  | Ref. |
| Plantae | Onagraceae | Epilobium dodonaei | Ref. |
| Plantae | Saxifragaceae | Tellima grandiflora | Ref. |
|
|
zoom in
| Organism | Arctostaphylos uva-ursi | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Geiger,Z.Naturforsch.B.,30,(1975),296
Markham,Tetrahedron,34,(1978),1389 |
|---|
|