| Name |
4''-O-Acetylafzelin Kaempferol 3-(3''-acetylrhamnoside) Kaempferol 3-O-(3'-O-acetyl-alpha-L-rhamnopyranoside) |
| Formula |
C23H22O11 |
| Mw |
474.11621155 |
| CAS RN |
135618-16-5 |
| C_ID |
C00005861
, 
|
| InChIKey |
APRVHMRKRPHQLM-RWUCQMPGNA-N |
| InChICode |
InChI=1S/C23H22O11/c1-9-17(28)21(32-10(2)24)19(30)23(31-9)34-22-18(29)16-14(27)7-13(26)8-15(16)33-20(22)11-3-5-12(25)6-4-11/h3-9,17,19,21,23,25-28,30H,1-2H3/t9-,17-,19-,21+,23-/m0/s1 |
| SMILES |
CC(=O)OC1[C@@H](O)C(C)O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Zingiber aromaticum  | Ref. |
| Plantae | Zingiberaceae | Zingiber zerumbe | Ref. |
| Plantae | Zingiberaceae | Zingiber zerumbet  | Ref. |
|
|
zoom in
| Organism | Zingiber zerumbe | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|