| Name |
Kaempferol 3-(2''-galloylglucoside) Kaempferol 3-O-(2''-O-galloyl)-beta-D-glucoside |
| Formula |
C28H24O15 |
| Mw |
600.1115201 |
| CAS RN |
76343-90-3 |
| C_ID |
C00005846
, 
|
| InChIKey |
UWIQWJHBYRTKAL-ZKJKSYOBNA-N |
| InChICode |
InChI=1S/C28H24O15/c29-9-18-21(36)23(38)26(42-27(39)11-5-15(33)20(35)16(34)6-11)28(41-18)43-25-22(37)19-14(32)7-13(31)8-17(19)40-24(25)10-1-3-12(30)4-2-10/h1-8,18,21,23,26,28-36,38H,9H2/t18-,21+,23-,26+,28-/m0/s1 |
| SMILES |
O=C(O[C@@H]1C(O)[C@H](O)C(CO)O[C@H]1Oc1c(-c2ccc(O)cc2)oc2cc(O)cc(O)c2c1=O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia humifusa | Ref. |
| Plantae | Euphorbiaceae | Euphorbia maculata  | Ref. |
| Plantae | Polygonaceae | Polygonum lapathifolium  | Ref. |
| Plantae | Polygonaceae | Polygonum nodosum | Ref. |
|
|
zoom in
| Organism | Euphorbia humifusa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|