| Name |
Hibiscetin 3-glucoside Hibiscetin 3-O-glucoside |
| Formula |
C21H20O14 |
| Mw |
496.08530535 |
| CAS RN |
482-34-8 |
| C_ID |
C00005793
, 
|
| InChIKey |
FYQLKIUMCHVQQI-DIGKNEFGNA-N |
| InChICode |
InChI=1S/C21H20O14/c22-4-10-14(29)16(31)17(32)21(33-10)35-20-15(30)11-6(23)3-9(26)13(28)19(11)34-18(20)5-1-7(24)12(27)8(25)2-5/h1-3,10,14,16-17,21-29,31-32H,4H2/t10-,14-,16-,17-,21+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2O[C@H](CO)[C@@H](O)C(O)C2O)c(-c2cc(O)c(O)c(O)c2)oc2c(O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Malvaceae | Hibiscus cannabinus  | Ref. |
| Plantae | Malvaceae | Hibiscus sabdariffa  | Ref. |
| - | - | Myrcianthes pungens | Ref. |
|
|
zoom in
| Organism | Hibiscus sabdariffa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Rao,Proc.Indian Acad.Sci.Sect.A,15,(1942),148
Seshadri,J.Indian Chem.Soc.,38,(1961),649 |
|---|
|