| Name |
Limocitrol 3-glucoside |
| Formula |
C24H26O14 |
| Mw |
538.13225554 |
| CAS RN |
77133-42-7 |
| C_ID |
C00005783
, 
|
| InChIKey |
PRBUAZIWXABBBW-SSOWEDBPNA-N |
| InChICode |
InChI=1S/C24H26O14/c1-33-10-6-8(4-5-9(10)26)19-23(38-24-17(31)16(30)13(27)11(7-25)36-24)15(29)12-14(28)21(34-2)18(32)22(35-3)20(12)37-19/h4-6,11,13,16-17,24-28,30-32H,7H2,1-3H3/t11-,13-,16+,17-,24+/m1/s1 |
| SMILES |
COc1cc(-c2oc3c(OC)c(O)c(OC)c(O)c3c(=O)c2O[C@@H]2O[C@H](CO)[C@@H](O)C(O)C2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Primulaceae | Primula officinalis  | Ref. |
| Plantae | Rutaceae | Citrus japonica  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
|
|
zoom in
| Organism | Citrus japonica | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Karl,Planta Med.,41,(1981),96
Gentili,Tetrahedron,20,(1964),2313 |
|---|
|